CAS 4118-51-8: 1-Methylethyl α-hydroxybenzeneacetate
Description:1-Methylethyl α-hydroxybenzeneacetate, also known by its CAS number 4118-51-8, is an organic compound characterized by its ester functional group. This substance features a benzene ring substituted with a hydroxyl group and an acetate moiety, which contributes to its chemical reactivity and potential applications. The presence of the α-hydroxy group indicates that it may exhibit properties typical of alcohols and phenols, such as hydrogen bonding capabilities, which can influence its solubility and interaction with other molecules. The compound is likely to be a colorless to pale yellow liquid, with a characteristic aromatic odor. Its molecular structure suggests potential uses in the synthesis of pharmaceuticals, fragrances, or as an intermediate in organic reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-8(2)14-11(13)10(12)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3
InChI key:InChIKey=SCJJMBMUZTUIJU-UHFFFAOYSA-N
SMILES:O=C(OC(C)C)C(O)C=1C=CC=CC1
- Synonyms:
- (±)-Isopropyl mandelate
- (±)-Mandelic acid isopropyl ester
- 1-Methylethyl α-hydroxybenzeneacetate
- Benzeneacetic acid, .alpha.-hydroxy-, 1-methylethyl ester
- Benzeneacetic acid, alpha-hydroxy-, 1-methylethyl ester (9CI)
- Benzeneacetic acid, α-hydroxy-, 1-methylethyl ester
- Isopropyl 2-hydroxy-2-phenylacetate
- NSC 6582
