CAS 4120-64-3
:(5E)-5-(4-nitrobenzylidene)-2-sulfanyl-1,3-thiazol-4(5H)-one
Description:
(5E)-5-(4-nitrobenzylidene)-2-sulfanyl-1,3-thiazol-4(5H)-one is a thiazole derivative characterized by its unique structural features, including a thiazole ring and a nitrobenzylidene substituent. This compound typically exhibits a yellow to orange color, which is common among compounds containing nitro groups. It is known for its potential biological activities, including antimicrobial and anticancer properties, attributed to the thiazole moiety and the electron-withdrawing nitro group that can enhance reactivity. The presence of the sulfanyl group contributes to its chemical reactivity, allowing for various substitution reactions. The compound is generally soluble in organic solvents, but its solubility in water is limited due to its hydrophobic characteristics. Its stability can be influenced by environmental factors such as pH and temperature. As with many thiazole derivatives, it may also exhibit fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. Proper handling and safety measures should be observed due to its potential toxicity and reactivity.
Formula:C10H6N2O3S2
InChI:InChI=1/C10H6N2O3S2/c13-9-8(17-10(16)11-9)5-6-1-3-7(4-2-6)12(14)15/h1-5H,(H,11,13,16)/b8-5+
Synonyms:- 4(5H)-thiazolone, 2-mercapto-5-[(4-nitrophenyl)methylene]-, (5E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5E)-2-Mercapto-5-(4-nitrobenzylidene)-1,3-thiazol-4(5h)-one
CAS:Formula:C10H6N2O3S2Color and Shape:SolidMolecular weight:266.2962
