CAS 41200-97-9
:1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene
Description:
1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene, with the CAS number 41200-97-9, is an organic compound characterized by its aromatic structure, which includes a nitro group and two chlorine substituents on the benzene ring. The presence of the 1-methylethoxy group introduces an ether functionality, contributing to its overall chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic nature. Its chemical behavior is influenced by the electron-withdrawing nitro group and the steric effects of the chlorines and the methylethoxy group, which can affect reactivity in electrophilic substitution reactions. Additionally, the compound may have applications in various fields, including pharmaceuticals and agrochemicals, although specific uses would depend on further research into its biological activity and environmental impact. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose health risks.
Formula:C9H9Cl2NO3
InChI:InChI=1S/C9H9Cl2NO3/c1-5(2)15-9-4-8(12(13)14)6(10)3-7(9)11/h3-5H,1-2H3
InChI key:InChIKey=USZMRJRYGHZJID-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC(N(=O)=O)=C(Cl)C=C1Cl
Synonyms:- Benzene, 1,5-dichloro-2-(1-methylethoxy)-4-nitro-
- 1,5-Dichloro-2-nitro-4-propan-2-yloxybenzene
- 2,4-Dichloro-5-isopropoxy nitro benzene
- 1,5-Dichloro-2-(1-methylethoxy)-4-nitrobenzene
- 2,4-Dichloro-5-nitrophenyl isopropyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,5-Dichloro-2-isopropoxy-4-nitrobenzene
CAS:Formula:C9H9Cl2NO3Color and Shape:SolidMolecular weight:250.07872,4-Dichloro-5-nitrophenyl Isopropyl Ether
CAS:Controlled Product<p>Applications A 2,4-disubstituted-5-nitrophenol used in the synthesis of the herbicide Oxadiazon.<br></p>Formula:C9H9Cl2NO3Color and Shape:NeatMolecular weight:250.08

