CAS 412009-61-1
:1-Ethyl-3-methylimidazolium hydrogen sulfate
Description:
1-Ethyl-3-methylimidazolium hydrogen sulfate is an ionic liquid characterized by its unique combination of an imidazolium cation and a hydrogen sulfate anion. This substance is typically a colorless to yellowish liquid at room temperature, exhibiting low volatility and high thermal stability, which makes it suitable for various applications in green chemistry. Its ionic nature contributes to its excellent solvation properties, allowing it to dissolve a wide range of organic and inorganic compounds. The presence of the ethyl and methyl groups on the imidazolium ring enhances its solubility and reduces viscosity compared to other ionic liquids. Additionally, it has a relatively low melting point, which is advantageous for its use in processes that require liquid phases. 1-Ethyl-3-methylimidazolium hydrogen sulfate is often utilized as a solvent in chemical reactions, particularly in catalysis and extraction processes, due to its ability to stabilize reactive intermediates and facilitate the dissolution of reactants. Its properties make it a subject of interest in the development of sustainable and environmentally friendly chemical processes.
Formula:C6H11N2·HO4S
InChI:InChI=1S/C6H11N2.H2O4S/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-6H,3H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1
InChI key:InChIKey=HZKDSQCZNUUQIF-UHFFFAOYSA-M
SMILES:C(C)[N+]1=CN(C)C=C1.S(=O)(=O)([O-])O
Synonyms:- 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate
- 1-Methyl-3-ethylimidazolium hydrogen sulfate
- 1H-Imidazolium, 1-ethyl-3-methyl-, sulfate (1:1)
- 1H-Imidazolium, 3-ethyl-1-methyl-, sulfate (1:1)
- 1-Ethyl-3-methylimidazolium hydrosulfate
- 1-Ethyl-3-methylimidazolium hydrogen sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Ethyl-3-methylimidazolium hydrogen sulfate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H12N2O4SPurity:98%Color and Shape:Liquid, Clear colourless to yellowMolecular weight:208.231-ETHYL-3-METHYLIMIDAZOLIUM HYDROGENSULFATE
CAS:Formula:C6H12N2O4SPurity:95%Color and Shape:LiquidMolecular weight:208.23551-Ethyl-3-Methylimidazolium Hydrogen Sulfate
CAS:1-Ethyl-3-Methylimidazolium Hydrogen SulfatePurity:99%Molecular weight:208.24g/mol1-Ethyl-3-methylimidazolium Hydrogen Sulfate
CAS:Purity:95%Color and Shape:LiquidMolecular weight:208.231-Ethyl-3-methylimidazolium Hydrogen Sulfate
CAS:Controlled ProductApplications 1-Ethyl-3-methylimidazolium hydrogen sulfate 95% (cas# 412009-61-1) is a useful research chemical.
Formula:C6H12N2O4SColor and Shape:NeatMolecular weight:208.24




