CAS 412018-72-5
:8-methoxyisochroman-4-one
Description:
8-Methoxyisochroman-4-one is a chemical compound characterized by its isoquinoline structure, which features a methoxy group (-OCH3) at the 8-position and a carbonyl group (C=O) at the 4-position of the isochroman ring system. This compound typically exhibits properties associated with aromatic compounds, including stability and potential for various chemical reactions due to the presence of the carbonyl group. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The methoxy group can influence the compound's solubility and reactivity, potentially enhancing its interaction with biological targets. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and boiling point. Overall, 8-methoxyisochroman-4-one is a versatile compound that may have applications in drug development and other fields of chemistry.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-12-10-4-2-3-7-8(10)5-13-6-9(7)11/h2-4H,5-6H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
