CAS 41202-32-8: Piperazine, 1-(2-chlorophenyl)-, hydrochloride (1:1)
Description:Piperazine, 1-(2-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the second position, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound is often studied for its pharmacological properties, including potential use in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its molecular structure allows for interactions with various biological targets, making it a subject of interest in drug design. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Overall, Piperazine, 1-(2-chlorophenyl)-, hydrochloride is a versatile compound with significant implications in both research and therapeutic contexts.
Formula:C10H13ClN2·ClH
InChI:InChI=1S/C10H13ClN2.ClH/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H
InChI key:InChIKey=GUTWDZXWTKMXPI-UHFFFAOYSA-N
SMILES:Cl.ClC=1C=CC=CC1N2CCNCC2
- Synonyms:
- 1-(2-Chloroethyl)Pyrrolidine Hydrochloride (1:1)
- 1-(2-Chlorophenyl)Piperazine Hydrochloride
- 1-(2-Chlorophenyl)piperazine HCL
- 1-(o-Chlorophenyl)-piperazine hydrochloride hydrate
- 1-4-(2-Chlorophenyl)piperazine monohydrochloride
- N-(2-Chlorophenyl)piperazine monohydrochloride
- Piperazine, 1-(2-chlorophenyl)-, hydrochloride (1:1)
- Piperazine, 1-(2-chlorophenyl)-, monohydrochloride
- 1-(2-Chlorophenyl)piperazine monohydrochloride
