CAS 41203-22-9
:1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
Description:
1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane, with the CAS number 41203-22-9, is a macrocyclic compound characterized by its unique structure that includes four nitrogen atoms and a cyclic framework. This compound belongs to the class of tetraazamacrocycles, which are known for their ability to form stable complexes with various metal ions, making them of interest in coordination chemistry and potential applications in catalysis and materials science. The presence of four methyl groups enhances its solubility and stability, while also influencing its steric and electronic properties. The tetraazacyclotetradecane framework provides a rigid structure that can facilitate the formation of chelate complexes. Additionally, this compound may exhibit interesting biological properties, including potential applications in drug delivery or as a ligand in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity.
Formula:C14H36N4
InChI:InChI=1/C14H32N4/c1-15-7-5-8-17(3)13-14-18(4)10-6-9-16(2)12-11-15/h5-14H2,1-4H3/p+4
Synonyms:- 1,4,8,11-Tetraazacyclotetradecane, 1,4,8,11-tetramethyl-
- 1,4,8,11-Tetramethyl-1,4,8,11-tetrazacyclotetradecane
- 1,4,8,11-Tetramethyl-1,4,8,11-Tetraazoniacyclotetradecane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
CAS:Formula:C14H32N4Purity:>98.0%(GC)(T)Color and Shape:White or Colorless to Almost white or Almost colorless powder to lump to clear liquidMolecular weight:256.441,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
CAS:<p>1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is used as a macrocyclic chelating agent in coordination chemistry. It is also used as a ligand which bind strongly to a wide range of metal ions and as crown ethers. This Thermo Scientific Chemicals brand product was originally part of the Alfa</p>Formula:C14H32N4Molecular weight:256.431,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane, 98%
CAS:<p>1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane, 98%</p>Formula:C14H32N4Purity:98%Color and Shape:white waxy xtl.Molecular weight:256.431,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
CAS:Formula:C14H32N4Purity:98%Color and Shape:SolidMolecular weight:256.43071,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
CAS:1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecanePurity:98%Molecular weight:256.44g/mol1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane
CAS:Formula:C14H32N4Purity:97%Color and Shape:SolidMolecular weight:256.438





