CAS 4122-56-9
:Methyl 2-formylbenzoate
Description:
Methyl 2-formylbenzoate, with the CAS number 4122-56-9, is an organic compound that belongs to the class of aromatic esters. It features a benzoate structure where a formyl group (-CHO) is positioned at the second carbon of the benzene ring, and a methyl ester group (-COOCH3) is attached to the carboxylic acid moiety. This compound is typically a colorless to pale yellow liquid with a pleasant aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 2-formylbenzoate is used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals, fragrances, and agrochemicals. Its reactivity is influenced by the presence of both the formyl and ester functional groups, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H8O3
InChI:InChI=1/C9H8O3/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-6H,1H3
SMILES:COC(=O)c1ccccc1C=O
Synonyms:- 2-Carbomethoxybenzaldehyde
- 2-Methoxycarbonylbenzaldehyde
- Benzoic Acid, 2-Formyl-, Methyl Ester
- Methyl o-formylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-Formylbenzoate
CAS:Formula:C9H8O3Purity:>98.0%(GC)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:164.16Methyl 2-formylbenzoate
CAS:Methyl 2-formylbenzoateFormula:C9H8O3Purity:98%Color and Shape: pale yellow liquidMolecular weight:164.16g/molMethyl 2-formylbenzoate
CAS:Formula:C9H8O3Purity:95%Color and Shape:Liquid, Colourless liquidMolecular weight:164.162-Carbomethoxybenzaldehyde
CAS:2-Carbomethoxybenzaldehyde (2CMB) is a synthetic chemical compound that has been used as an efficient method for the synthesis of amines. The carbonyl group in 2CMB reacts with nucleophiles, such as amines, to form a tetrahydroisoquinoline derivative. This nucleophilic attack leads to the formation of an unstable intermediate that can be isolated and purified by trifluoroacetic acid (TFA). 2CMB is also used in the synthesis of quinoline derivatives and naphthalene derivatives. The acidic properties of 2CMB allow it to react with carboxylic acids, leading to the formation of esters.
Formula:C9H8O3Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:164.16 g/molRef: 3D-FC70309
Discontinued product




