CAS 4122-68-3
:(4-Chlorophenoxy)acetyl chloride
Description:
(4-Chlorophenoxy)acetyl chloride, with the CAS number 4122-68-3, is an organic compound characterized by its functional groups, which include an acyl chloride and a phenoxy group. It typically appears as a colorless to pale yellow liquid with a pungent odor. This compound is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the production of pharmaceuticals and agrochemicals. It can undergo nucleophilic acyl substitution reactions, allowing it to react with various nucleophiles, including amines and alcohols, to form corresponding amides and esters. Additionally, (4-Chlorophenoxy)acetyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze to produce hydrochloric acid and the corresponding phenolic compound. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance due to its corrosive nature and potential health hazards.
Formula:C8H6Cl2O2
InChI:InChI=1S/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2
InChI key:InChIKey=VRBVHQUSAOKVDH-UHFFFAOYSA-N
SMILES:O(CC(Cl)=O)C1=CC=C(Cl)C=C1
Synonyms:- (4-Chlorophenoxy)acetic acid chloride
- (4-Chlorophenoxy)acetyl chloride
- (p-Chlorophenoxy)acetyl chloride
- 2-(4-Chlorophenoxy)acetyl chloride
- Acetyl chloride, (4-chlorophenoxy)-
- Acetyl chloride, (p-chlorophenoxy)-
- Acetyl chloride, 2-(4-chlorophenoxy)-
- NSC 20549
- P-Chlorophenoxyacetyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chlorophenoxyacetyl chloride
CAS:Formula:C8H6Cl2O2Purity:98%Color and Shape:SolidMolecular weight:205.03804-Chlorophenoxyacetyl chloride
CAS:4-Chlorophenoxyacetyl chlorideFormula:C8H6Cl2O2Purity:98%Color and Shape: clear. colourless liquidMolecular weight:205.04g/mol4-Chlorophenoxyacetyl Chloride
CAS:Formula:C8H6Cl2O2Purity:>98.0%(T)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:205.034-Chlorophenoxyacetyl Chloride
CAS:4-Chlorophenoxyacetyl Chloride (4CPAC) is a synthetic compound that has been shown to have biological properties in the inhibition of cell function, which may be due to its ability to bind with a specific ligand. 4CPAC is also a pesticide and has been shown to be effective against nematodes and pests. 4CPAC has hypotensive effects and can be used as an antihypertensive drug. The hydroxyl group on the left side of the molecule enables it to act as a sulfoxide, which is an organic chemical that reacts with other molecules in order to form new compounds.Formula:C8H6O2Cl2Purity:Min. 95%Molecular weight:205.03 g/mol



