CAS 41223-27-2
:4-Methoxy-2-butanol
Description:
4-Methoxy-2-butanol is an organic compound characterized by its molecular structure, which includes a butanol backbone with a methoxy group (-OCH3) attached to the fourth carbon. This compound is typically a colorless liquid with a mild odor and is soluble in water due to the presence of the hydroxyl (-OH) group, which enhances its polarity. It has applications in various fields, including as a solvent in chemical reactions and formulations, and may also be used in the synthesis of other organic compounds. The presence of both the methoxy and hydroxyl functional groups contributes to its reactivity, allowing it to participate in various chemical reactions such as etherification and esterification. Additionally, 4-Methoxy-2-butanol's physical properties, such as boiling point and density, are influenced by its molecular weight and structure, making it an interesting compound for both industrial and research applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H12O2
InChI:InChI=1S/C5H12O2/c1-5(6)3-4-7-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=METPUBMTPUYMGR-UHFFFAOYSA-N
SMILES:C(C(C)O)COC
Synonyms:- 1-Methoxy-3-hydroxybutane
- 2-Butanol, 4-Methoxy-
- 4-Methoxybutan-2-ol
- 4-Methoxy-2-butanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-methoxybutan-2-ol
CAS:Controlled ProductApplications 4-methoxybutan-2-ol (cas# 41223-27-2) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C5H12O2Color and Shape:NeatMolecular weight:104.15
