CAS 412278-71-8

6-amino-1,2,4-triazine-5-carboxylic acid

Description:

6-Amino-1,2,4-triazine-5-carboxylic acid is a heterocyclic organic compound characterized by its triazine ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the triazine ring, contributing to its potential as a versatile building block in organic synthesis and pharmaceuticals. The presence of these functional groups imparts both basic and acidic properties, allowing for various chemical reactions, such as amide formation and esterification. Additionally, the compound's structure suggests potential applications in agrochemicals, particularly as herbicides or fungicides, due to its ability to interact with biological systems. Its solubility in polar solvents and stability under standard conditions make it suitable for various laboratory applications. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation into its pharmacological properties. Overall, 6-amino-1,2,4-triazine-5-carboxylic acid is a compound of interest in both synthetic chemistry and potential agricultural applications.

Formula: C₄H₄N₄O₂

InChI: InChI=1/C4H4N4O2/c5-3-2(4(9)10)6-1-7-8-3/h1H,(H2,5,8)(H,9,10)

SMILES: c1nc(c(N)nn1)C(=O)O

Synonyms:

• 1,2,4-Triazine-5-Carboxylic Acid, 6-Amino-
• 6-Amino-1,2,4-triazine-5-carboxylic acid1,2,4-Triazine-5-Carboxylicacid, 6-Amino-

6-Amino-[1,2,4]triazine-5-carboxylic acid

CAS: 412278-71-8

Formula: C₄H₄N₄O₂

Purity: 95%

Molecular weight: 140.1002

Ref: IN-DA00CARY