CAS 412281-11-9
:1-methylpyrrolidine-3-carboxylic acid
Description:
1-Methylpyrrolidine-3-carboxylic acid is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group at the 3-position and a methyl group at the 1-position of the pyrrolidine ring. It is a chiral molecule, meaning it can exist in different stereoisomeric forms, which can have distinct biological activities. The presence of the carboxylic acid group contributes to its acidity and potential reactivity in various chemical reactions, including esterification and amidation. This compound may exhibit solubility in polar solvents due to the hydrophilic nature of the carboxylic acid group. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs that target the central nervous system or other biological pathways. As with many organic compounds, the specific properties such as melting point, boiling point, and solubility can vary based on the molecular environment and conditions.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-7-3-2-5(4-7)6(8)9/h5H,2-4H2,1H3,(H,8,9)
SMILES:CN1CCC(C1)C(=O)O
Synonyms:- 3-Pyrrolidinecarboxylic Acid, 1-Methyl-
- 1-methyl-3-Pyrrolidinecarboxylicacid
- 1-Methyl-3-pyrrolidinecarboxylic acid
- 1-Methyl-Pyrrolidine-3-Carboxylic Acid Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-methylpyrrolidine-3-carboxylic acid
CAS:Formula:C6H11NO2Purity:95%Color and Shape:SolidMolecular weight:129.15701-Methylpyrrolidine-3-carboxylic acid
CAS:1-Methylpyrrolidine-3-carboxylic acidFormula:C6H11NO2Purity:98%Color and Shape: yellow solidMolecular weight:129.16g/mol1-Methyl-pyrrolidine-3-carboxylic acid
CAS:1-Methyl-pyrrolidine-3-carboxylic acid is a hepatoprotective agent that has been shown to inhibit the growth of cervical glands in animals. It also has anticarcinogenic and locomotor activity, as well as antidiabetic and depressant activities. The alkaloid 1-methyl-pyrrolidine-3-carboxylic acid can be found in many medicinal plants, including Ganoderma lucidum and Semen erythrophlei. In vitro assays show that this compound inhibits the enzyme lipase, which is involved in fat digestion and pancreatic function. The compound also has a depressant effect on the central nervous system, as shown by animal studies.Formula:C6H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:129.16 g/mol



