CAS 412298-86-3: (5,5-dimethyl-2-oxotetrahydrofuran-3-yl)acetic acid

Description: (5,5-Dimethyl-2-oxotetrahydrofuran-3-yl)acetic acid is a chemical compound characterized by its unique structure, which includes a tetrahydrofuran ring with a ketone and an acetic acid functional group. This compound features a five-membered cyclic ether, contributing to its stability and reactivity. The presence of the dimethyl groups enhances its steric properties, potentially influencing its interactions in biological systems or chemical reactions. The carboxylic acid group provides acidic characteristics, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the compound may exhibit solubility in polar solvents due to the presence of the carboxylic acid, while the cyclic structure may impart some hydrophobic characteristics. Its potential applications could span pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₈H₁₂O₄

InChI: InChI=1/C8H12O4/c1-8(2)4-5(3-6(9)10)7(11)12-8/h5H,3-4H2,1-2H3,(H,9,10)

Synonyms:

• 3-Furanacetic acid, tetrahydro-5,5-dimethyl-2-oxo-
• (5,5-Dimethyl-2-oxotetrahydrofuran-3-yl)acetic acid

(5,5-DIMETHYL-2-OXO-TETRAHYDRO-FURAN-3-YL)-ACETIC ACID

CAS: 412298-86-3

• Formula: C₈H₁₂O₄
• Molecular weight: 172.1785

(5,5-Dimethyl-2-oxo-tetrahydro-furan-3-yl)-acetic acid

CAS: 412298-86-3

Versatile small molecule scaffold

• Formula: C₈H₁₂O₄
• Purity: Min. 95%
• Molecular weight: 172.18 g/mol