CAS 4123-72-2

4-Amino-3,5-dibromobenzoic acid

Description:

4-Amino-3,5-dibromobenzoic acid is an organic compound characterized by the presence of an amino group and two bromine substituents on a benzoic acid framework. It features a carboxylic acid functional group (-COOH) that contributes to its acidic properties. The amino group (-NH2) is located at the para position relative to the carboxylic acid, while the bromine atoms are positioned at the meta positions on the aromatic ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its bromine substituents can influence its reactivity and stability, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The presence of both electron-withdrawing (bromine) and electron-donating (amino) groups can affect its electronic properties, making it an interesting subject for studies in organic chemistry and materials science. Safety precautions should be taken when handling this compound, as with many halogenated organic substances.

Formula: C₇H₅Br₂NO₂

InChI: InChI=1/C7H5Br2NO2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,10H2,(H,11,12)

SMILES: c1c(cc(c(c1Br)N)Br)C(=O)O

Synonyms:

• Benzoic Acid, 4-Amino-3,5-Dibromo-
• 4-AMINO-3,5-DIBROMOBENZOIC ACID
• BUTTPARK 35\03-07
• RARECHEM AL BO 2270

4-Amino-3,5-dibromobenzoic acid

CAS: 4123-72-2

Formula: C₇H₅Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 294.9281

Ref: IN-DA00C0JI

4-Amino-3,5-dibromobenzoic acid

CAS: 4123-72-2

4-Amino-3,5-dibromobenzoic acid

Purity: 97%

Molecular weight: 294.93g/mol

Ref: 54-OR321012

4-Amino-3,5-dibromobenzoic acid

CAS: 4123-72-2

The functional theory can be used to describe the chemical reactions that are involved in the formation of 4-amino-3,5-dibromobenzoic acid. The reaction involves a nucleophilic substitution reaction and an electrophilic substitution reaction. 4-Amino-3,5-dibromobenzoic acid is a white crystalline solid with a melting point of 110°C. It has antibacterial activity and is used in the production of polymers such as methyl methacrylate, dimethoxybenzoic acid, and benzoate esters.

Formula: C₇H₅Br₂NO₂

Purity: Min. 95%

Molecular weight: 294.93 g/mol

Ref: 3D-FA70930

4-Amino-3,5-dibromobenzoic acid

CAS: 4123-72-2

Formula: C₇H₅Br₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.93

Ref: 10-F092302