CAS 412347-30-9

5-Bromo-3-(piperazin-1-yl)pyridine

Description:

5-Bromo-3-(piperazin-1-yl)pyridine is a chemical compound characterized by its pyridine ring substituted with a bromine atom and a piperazine moiety. The presence of the bromine atom at the 5-position of the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. The piperazine group, known for its ability to form hydrogen bonds and interact with biological targets, enhances the compound's pharmacological properties. This substance is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure suggests potential use in the development of pharmaceuticals, particularly in the fields of neuropharmacology and anti-cancer research, due to the ability of piperazine derivatives to interact with various receptors and enzymes. Additionally, the compound's unique combination of functional groups may allow for further derivatization, making it a valuable intermediate in synthetic organic chemistry. Safety and handling precautions should be observed, as with any brominated compound, due to potential toxicity and environmental concerns.

Formula: C₉H₁₂BrN₃

InChI: InChI=1/C9H12BrN3/c10-8-5-9(7-12-6-8)13-3-1-11-2-4-13/h5-7,11H,1-4H2

SMILES: C1CN(CCN1)c1cc(cnc1)Br

Synonyms:

• 1-(5-Bromopyridin-3-yl)piperazine
• Piperazine, 1-(5-Bromo-3-Pyridinyl)-

1-(5-Bromo-3-pyridyl)piperazine

CAS: 412347-30-9

Formula: C₉H₁₂BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 242.1157

Ref: IN-DA00CIY1

1-(5-Bromo-3-pyridyl)piperazine

CAS: 412347-30-9

1-(5-Bromo-3-pyridyl)piperazine

Purity: 96%

Molecular weight: 242.12g/mol

Ref: 54-OR52760

1-(5-Bromopyridin-3-yl)piperazine

CAS: 412347-30-9

Formula: C₉H₁₂BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 242.12

Ref: 10-F319556