CAS 41242-94-8
:quinoxalin-2-ylmethanol
Description:
Quinoxalin-2-ylmethanol is an organic compound characterized by its quinoxaline structure, which consists of a bicyclic aromatic system containing two nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) attached to the second position of the quinoxaline ring, contributing to its reactivity and potential applications in various chemical reactions. Quinoxalin-2-ylmethanol is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents due to the presence of the hydroxymethyl group. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and spectral characteristics, can be determined through standard analytical techniques like NMR, IR, and mass spectrometry. Overall, quinoxalin-2-ylmethanol serves as a valuable building block in organic synthesis and has potential applications in pharmaceuticals and agrochemicals.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c12-6-7-5-10-8-3-1-2-4-9(8)11-7/h1-5,12H,6H2
SMILES:c1ccc2c(c1)ncc(CO)n2
Synonyms:- 2-Quinoxalinemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: 10-F230830
1g148.00€5g584.00€10g1,149.00€25g2,679.00€2.5g311.00€100mg56.00€250mg71.00€500mg126.00€H-Imidazo[1,2-a]pyridine-3-carbaldehyde
CAS:H-Imidazo[1,2-a]pyridine-3-carbaldehyde is an anti-infective agent that is active against bacteria and fungi. The compound inhibits the growth of bacteria by interfering with the synthesis of DNA and RNA. H-Imidazo[1,2-a]pyridine-3-carbaldehyde has been shown to be effective in treating infections caused by Stenotrophomonas maltophilia and Pseudomonas aeruginosa. It also has an effect on Enterobacteriaceae, including Escherichia coli, Klebsiella pneumoniae, and Proteus mirabilis. H-Imidazo[1,2-a]pyridine-3-carbaldehyde is not effective against Streptococcus species such as Streptococcus pyogenes or Group A beta hemolytic streptococci.Formula:C9H8N2OPurity:Min. 95%Molecular weight:160.17 g/mol



