CAS 41244-53-5

2,4-bis(benzyloxy)-5-bromopyrimidine

Description:

2,4-bis(benzyloxy)-5-bromopyrimidine is an organic compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing nitrogen atoms at the 1 and 3 positions. The presence of two benzyloxy groups at the 2 and 4 positions enhances its solubility and reactivity, making it useful in various synthetic applications. The bromine atom at the 5 position introduces a halogen functionality, which can participate in nucleophilic substitution reactions, thereby expanding its utility in organic synthesis. This compound typically exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases, which can lead to hydrolysis of the benzyloxy groups. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the compound's unique combination of functional groups may impart specific electronic properties, influencing its reactivity and interactions with other molecules. Overall, 2,4-bis(benzyloxy)-5-bromopyrimidine serves as a versatile building block in the development of pharmaceuticals and agrochemicals.

Formula: C₁₈H₁₅BrN₂O₂

InChI: InChI=1/C18H15BrN2O2/c19-16-11-20-18(23-13-15-9-5-2-6-10-15)21-17(16)22-12-14-7-3-1-4-8-14/h1-11H,12-13H2

SMILES: c1ccc(cc1)COc1c(cnc(n1)OCc1ccccc1)Br

Synonyms:

• Pyrimidine, 5-bromo-2,4-bis(phenylmethoxy)-
• 2,4-Bis(benzyloxy)-5-bromopyrimidine

2,4-Bis(benzyloxy)-5-bromopyrimidine

CAS: 41244-53-5

Formula: C₁₈H₁₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 371.2279

Ref: IN-DA003FOP

5-Bromo-2,4-di(benzyloxy)pyrimidine

CAS: 41244-53-5

5-Bromo-2,4-di(benzyloxy)pyrimidine

Purity: 96%

Molecular weight: 371.23g/mol

Ref: 54-OR4413

2,4-Bis(benzyloxy)-5-bromopyrimidine

CAS: 41244-53-5

Purity: 95.0%

Molecular weight: 371.2340087890625

Ref: 10-F076040

5-Bromo-2,4-di(benzyloxy)pyrimidine

CAS: 41244-53-5

5-Bromo-2,4-di(benzyloxy)pyrimidine is an activator of DNA and RNA synthesis. It is a phosphoramidite that is used in the synthesis of oligonucleotides. 5-Bromo-2,4-di(benzyloxy)pyrimidine has antiviral activity and can inhibit the replication of HIV in vitro. This compound also has anticancer activity when it is given as a monophosphate, while its diphosphate form inhibits DNA and RNA synthesis. 5-Bromo-2,4-di(benzyloxy)pyrimidine can be synthesized from 2,4-dibenzyloxy pyrimidine and bromine in high purity with a CAS number 41244-53-5.

Formula: C₁₈H₁₅BrN₂O₂

Purity: Min. 95%

Molecular weight: 371.23 g/mol

Ref: 3D-NB57419