CAS 41247-05-6: dl-Xylose

Description:dl-Xylose is a five-carbon sugar, specifically a pentose, that is classified as an aldose due to the presence of an aldehyde functional group. It is a white crystalline solid that is soluble in water, exhibiting a sweet taste. dl-Xylose is an isomer of xylose, meaning it has the same molecular formula but differs in the arrangement of atoms. It is commonly found in various plant materials, particularly in the hemicellulose of wood and in some fruits. The substance plays a significant role in carbohydrate metabolism and is often used in biochemical research, particularly in studies related to sugar absorption and metabolism. In terms of its chemical properties, dl-xylose can participate in various reactions typical of sugars, including oxidation and reduction. It is also utilized in the food industry as a sweetener and in the production of certain pharmaceuticals. Safety data indicates that it is generally recognized as safe when consumed in moderate amounts, although excessive intake may lead to gastrointestinal discomfort.

Formula:C₅H₁₀O₅

InChI:InChI=1/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/s2

InChI key:InChIKey=PYMYPHUHKUWMLA-QXZWWJJYNA-N

SMILES:O=CC(O)C(O)C(O)CO