CAS 41250-31-1

(5E)-5-[4-(dimethylamino)benzylidene]-2-thioxoimidazolidin-4-one

Description:

The chemical substance known as (5E)-5-[4-(dimethylamino)benzylidene]-2-thioxoimidazolidin-4-one, with the CAS number 41250-31-1, is a synthetic organic compound characterized by its imidazolidinone core structure. This compound features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of a dimethylamino group indicates that it may exhibit basic properties, potentially influencing its solubility and interaction with biological systems. The benzylidene moiety suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications and safety profile.

Formula: C₁₂H₁₃N₃OS

InChI: InChI=1/C12H13N3OS/c1-15(2)9-5-3-8(4-6-9)7-10-11(16)14-12(17)13-10/h3-7H,1-2H3,(H2,13,14,16,17)/b10-7+

Synonyms:

• 4-imidazolidinone, 5-[[4-(dimethylamino)phenyl]methylene]-2-thioxo-, (5E)-
• (5E)-5-[4-(Dimethylamino)benzylidene]-2-thioxoimidazolidin-4-one

5-{[4-(Dimethylamino)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one

CAS: 41250-31-1

5-{[4-(Dimethylamino)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one is a reagent that can be used in the spectrophotometric measurement of metal ions. This reagent is a colorless solid that can be used as a solvent for metal ions. 5-{[4-(Dimethylamino)phenyl]methylidene}-2-sulfanylideneimidazolidin-4-one will react with the metal ion to form a complex, which will absorb light at specific wavelengths depending on the type of metal ion and its concentration. The stoichiometric constant and photometric constant are related to the wavelength of light absorbed by the complex formed from the reagent and metal ion.

Formula: C₁₂H₁₃N₃OS

Purity: Min. 95%

Molecular weight: 247.32 g/mol

Ref: 3D-RBA25031