CymitQuimica logo

CAS 41276-30-6

:

1-Benzyl-3-ethoxycarbonyl-4-piperidone

Description:
1-Benzyl-3-ethoxycarbonyl-4-piperidone, with the CAS number 41276-30-6, is a chemical compound that belongs to the class of piperidones, which are cyclic amides derived from piperidine. This compound features a piperidone ring substituted with a benzyl group and an ethoxycarbonyl group, contributing to its unique chemical properties. It typically appears as a solid or crystalline substance and is characterized by its moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water. The presence of the ethoxycarbonyl group enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H19NO3
InChI:InChI=1S/C15H19NO3/c1-2-19-15(18)13-11-16(9-8-14(13)17)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3
InChI key:ROSZJQBQGFBFSW-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2
Found 3 products.