CAS 4128-17-0
:(E,E)-Farnesyl acetate
Description:
(E,E)-Farnesyl acetate is an organic compound classified as a sesquiterpene ester. It is characterized by its molecular structure, which includes a farnesyl group (a 15-carbon chain) linked to an acetate moiety. This compound is typically colorless to pale yellow in appearance and has a pleasant, sweet, and floral aroma, making it valuable in the fragrance and flavor industries. Its chemical formula is C15H26O2, and it has a relatively low molecular weight. (E,E)-Farnesyl acetate is known for its stability under normal conditions, but it may be sensitive to light and air, which can lead to degradation over time. It is soluble in organic solvents such as ethanol and oils but has limited solubility in water. In terms of applications, it is often used in perfumes, cosmetics, and food flavorings due to its aromatic properties. Additionally, it may exhibit biological activities, including potential antimicrobial effects, although further research is needed to fully understand its pharmacological properties.
Formula:C17H28O2
InChI:InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+
InChI key:InChIKey=ZGIGZINMAOQWLX-NCZFFCEISA-N
SMILES:C(=C/CC/C(=C/COC(C)=O)/C)(\CCC=C(C)C)/C
Synonyms:- (2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl acetate
- (2E,6E)-Farnesyl acetate
- (E,E)-Farnesyl acetate
- 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, 1-acetate, (2E,6E)-
- 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, (2E,6E)-
- 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, (E,E)-
- 2-trans-6-trans-Farnesyl acetate
- Acetic acid (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl ester
- Acetic acid (2E,6E)-farnesyl ester
- Acetic acid farnesyl ester
- all-trans-Farnesyl acetate
- trans,trans-Farnesol acetate
- trans,trans-Farnesyl acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl Acetate
CAS:Controlled Product<p>Applications (2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl Acetate is an intermediate in the synthesis of JHSB3 (J211030). JHSB3 is an acyclic sesquiterpenoid that regulates many aspects of insect physiology. Juvenile Hormone regulate development, reproduction, diapause, and polyphenisms.<br>References Kotaki, T., et al.: Org. Let., 11, 5234 (2009); Riddiford, L.: Adv. Insect Physiol., 24, 213 (1994); Wyatt, G., Davey, K.: Adv. Insect Physiol., 26, 1 (1996); Nijhout, H.: Insect Hormones (Princeton Univ. Press, Princeton) (1994)<br></p>Formula:C17H28O2Color and Shape:NeatMolecular weight:264.4

