CAS 412923-40-1

2-bromothiazolo[5,4-b]pyridine

Description:

2-Bromothiazolo[5,4-b]pyridine is a heterocyclic compound characterized by the presence of both bromine and a thiazole ring fused to a pyridine structure. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activity, making it of interest in medicinal chemistry. The thiazole and pyridine moieties contribute to its electronic properties, influencing its reactivity and interaction with biological targets. The bromine substituent can enhance the compound's lipophilicity and may play a role in its pharmacological profile. In terms of solubility, it is generally soluble in organic solvents, which is common for many heterocycles. The compound's unique structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, its potential applications in drug discovery highlight the importance of understanding its chemical properties, stability, and reactivity under different conditions. Overall, 2-bromothiazolo[5,4-b]pyridine represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₆H₃BrN₂S

InChI: InChI=1/C6H3BrN2S/c7-6-9-4-2-1-3-8-5(4)10-6/h1-3H

SMILES: c1cc2c(nc1)sc(Br)n2

2-Bromothiazolo[5,4-b]pyridine

CAS: 412923-40-1

Formula: C₆H₃BrN₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 215.0704

Ref: IN-DA0072QH

2-Bromothiazolo[5,4-b]pyridine

CAS: 412923-40-1

2-Bromothiazolo[5,4-b]pyridine

Purity: 95%

Molecular weight: 215.07g/mol

Ref: 54-OR82884

2-Bromothiazolo[5,4-b]pyridine

CAS: 412923-40-1

Formula: C₆H₃BrN₂S

Purity: 95%

Color and Shape: Yellow powder

Molecular weight: 215.07

Ref: 10-F076867