CAS 412947-54-7
:Methyl 3-amino-4-iodobenzoate
Description:
Methyl 3-amino-4-iodobenzoate, with the CAS number 412947-54-7, is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with an amino group and an iodine atom. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. The presence of the amino group (-NH2) suggests that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. The iodine substituent enhances its reactivity and can facilitate further functionalization. Methyl 3-amino-4-iodobenzoate may also exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C8H8INO2
InChI:InChI=1/C8H8INO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,10H2,1H3
SMILES:COC(=O)c1ccc(c(c1)N)I
Synonyms:- 3-Amino-4-iodobenzoic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-amino-4-iodobenzoate, 97%
CAS:Methyl 3-amino-4-iodobenzoate is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informationFormula:C8H8INO2Purity:97%Color and Shape:Powder, YellowMolecular weight:277.06Methyl 3-amino-4-iodobenzoate
CAS:Formula:C8H8INO2Purity:98%Color and Shape:SolidMolecular weight:277.0591Methyl 3-amino-4-iodobenzoate
CAS:Methyl 3-amino-4-iodobenzoatePurity:97%Molecular weight:277.06g/molMethyl 3-amino-4-iodobenzoate
CAS:Formula:C8H8INO2Purity:96%Color and Shape:SolidMolecular weight:277.061



