CAS 41295-55-0
:4-(chloromethyl)-7-methoxy-2H-chromen-2-one
Description:
4-(Chloromethyl)-7-methoxy-2H-chromen-2-one, with the CAS number 41295-55-0, is a synthetic organic compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted with a chloromethyl group at the 4-position and a methoxy group at the 7-position. The presence of the chloromethyl group enhances its reactivity, making it a potential intermediate in organic synthesis. The methoxy group contributes to the compound's solubility and may influence its biological activity. Typically, compounds of this nature exhibit a range of biological properties, including antioxidant, anti-inflammatory, and antimicrobial activities, although specific activities can vary based on structural modifications and environmental conditions. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in medicinal chemistry and material science. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be hazardous.
Formula:C11H9ClO3
InChI:InChI=1/C11H9ClO3/c1-14-8-2-3-9-7(6-12)4-11(13)15-10(9)5-8/h2-5H,6H2,1H3
SMILES:COc1ccc2c(cc(=O)oc2c1)CCl
Synonyms:- 2H-1-benzopyran-2-one, 4-(chloromethyl)-7-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(Chloromethyl)-7-methoxy-2H-chromen-2-one
CAS:4-(Chloromethyl)-7-methoxy-2H-chromen-2-oneFormula:C11H9ClO3Purity:TechColor and Shape: faint beige powderMolecular weight:224.64g/mol4-Chloromethyl-7-methoxy-chromen-2-one
CAS:4-Chloromethyl-7-methoxy-chromen-2-one is a chemical compound that is used as a crosslinker in the chemosensor toolkit. It is used to identify aziridinium ions, which are produced by the reaction of picric acid with nucleophiles such as amines. 4-Chloromethyl-7-methoxy-chromen-2-one has been shown to be an effective treatment for inflammatory diseases and neutrophil function. This molecule also has coumarin derivatives that can be used for the treatment of cancer and other diseases.Formula:C11H9ClO3Purity:Min. 95%Molecular weight:224.64 g/mol


