
CAS 4130-19-2
:Gp4G
Description:
Gp4G, also known as guanosine 5'-diphosphate 4'-guanylate, is a nucleotide derivative characterized by its role in cellular signaling and metabolism. It is a cyclic dinucleotide that plays a crucial role in various biological processes, including immune response and regulation of gene expression. Gp4G is recognized for its ability to activate specific receptors, leading to downstream signaling pathways that can influence cellular functions. The substance is typically soluble in water, which facilitates its interaction with biological molecules. Its structure includes a guanine base, ribose sugar, and phosphate groups, contributing to its stability and reactivity. Gp4G is of interest in research related to immunology and cell biology, particularly in understanding how cells communicate and respond to external stimuli. As a relatively small molecule, it can easily penetrate cell membranes, making it a valuable tool in studying intracellular signaling mechanisms. Overall, Gp4G is significant in both basic research and potential therapeutic applications.
Formula:C20H28N10O21P4
InChI:InChI=1S/C20H28N10O21P4/c21-19-25-13-7(15(35)27-19)23-3-29(13)17-11(33)9(31)5(47-17)1-45-52(37,38)49-54(41,42)51-55(43,44)50-53(39,40)46-2-6-10(32)12(34)18(48-6)30-4-24-8-14(30)26-20(22)28-16(8)36/h3-6,9-12,17-18,31-34H,1-2H2,(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H3,21,25,27,35)(H3,22,26,28,36)/t5-,6-,9-,10-,11-,12-,17-,18-/m1/s1
InChI key:InChIKey=OLGWXCQXRSSQPO-MHARETSRSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](COP(OP(OP(OP(OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)N5C6=C(N=C5)C(=O)N=C(N)N6)(=O)O)(=O)O)(=O)O)(=O)O)[C@H]1O
Synonyms:- Guanosine 5′-(pentahydrogen tetraphosphate), P′′′→5′-ester with guanosine
- P1,P4-Diguanosine 5′-tetraphosphate
- Diguanosine 5′-tetraphosphate
- Guanosine 5′-(pentahydrogen tetraphosphate), 5′→5′-ester with guanosine
- Guanosine 5′-tetraphosphate, 5′-ester with guanosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
