CAS 41303-74-6: (4aS,6R,8aS)-3-methoxy-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol
Description:The chemical substance known as (4aS,6R,8aS)-3-methoxy-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol, with the CAS number 41303-74-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both benzofuro and benzazepine moieties. This compound features multiple stereocenters, which contribute to its specific three-dimensional configuration, influencing its biological activity and interactions. The presence of a methoxy group enhances its solubility and may affect its pharmacological properties. Additionally, the hexahydro framework indicates that it is a saturated compound, which may impact its reactivity and stability. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in neuropharmacology or as modulators of neurotransmitter systems. The specific stereochemistry and functional groups present in this molecule are crucial for understanding its mechanism of action and potential uses in drug development.
Formula:C16H19NO3
InChI:InChI=1/C16H19NO3/c1-19-12-3-2-10-9-17-7-6-16-5-4-11(18)8-13(16)20-15(12)14(10)16/h2-5,11,13,17-18H,6-9H2,1H3/t11-,13-,16-/m0/s1
- Synonyms:
- 6H-benzofuro[3a,3,2-ef][2]benzazepin-6-ol, 4a,5,9,10,11,12-hexahydro-3-methoxy-, (4aS,6R,8aS)-
![(4aS,6R,8aS)-3-methoxy-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol](https://static.cymitquimica.com/cas-image/340377-4as-6r-8as-3-methoxy-569101112-hexahydro-4ah-1-benzofuro-3a-32-ef-2-benzazepin-6-ol.png)
