CAS 41307-63-5: 3',6'-dihydroxy-3H-spiro[benzo[de]isochromene-1,9'-xanthen]-3-one
Description:3',6'-Dihydroxy-3H-spiro[benzo[de]isochromene-1,9'-xanthen]-3-one, with the CAS number 41307-63-5, is a chemical compound characterized by its complex spirocyclic structure, which incorporates both a benzo[de]isochromene and a xanthenone moiety. This compound features two hydroxyl groups at the 3' and 6' positions, contributing to its potential reactivity and solubility properties. The presence of these hydroxyl groups can enhance its ability to form hydrogen bonds, influencing its interactions in biological systems and its potential applications in pharmaceuticals or as a dye. The spiro structure provides unique geometric and electronic properties, which may affect its optical characteristics, making it of interest in materials science and organic electronics. Additionally, the compound may exhibit fluorescence, which is a valuable property for applications in imaging and sensing technologies. Overall, the unique structural features of this compound suggest a range of potential applications in various fields, including medicinal chemistry and materials science.
Formula:C24H14O5
InChI:InChI=1/C24H14O5/c25-14-7-9-17-20(11-14)28-21-12-15(26)8-10-18(21)24(17)19-6-2-4-13-3-1-5-16(22(13)19)23(27)29-24/h1-12,25-26H
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Resorcinolnaphthalein REF: TM-T13865CAS: 41307-63-5 | 98.18% | To inquire | Fri 11 Apr 25 |
![]() | Resorcinolnaphthalein REF: 3D-RBA30763CAS: 41307-63-5 | Min. 95% | To inquire | Fri 23 May 25 |

Resorcinolnaphthalein
Ref: TM-T13865
10mg | 47.00 € | ||
25mg | 70.00 € | ||
1mL*10mM (DMSO) | 50.00 € |

Resorcinolnaphthalein
Ref: 3D-RBA30763
100mg | 1,028.00 € |