CAS 41312-47-4
:3-Fucosyllactose
Description:
3-Fucosyllactose is a complex carbohydrate classified as a fucosylated oligosaccharide. It is composed of a lactose core with a fucose sugar attached at the 3-position of the galactose unit. This compound is notable for its role in human milk, where it serves as a prebiotic, promoting the growth of beneficial gut bacteria and contributing to the development of the infant's immune system. 3-Fucosyllactose is soluble in water and exhibits a sweet taste, characteristic of many oligosaccharides. Its structure allows it to participate in various biological interactions, including cell signaling and adhesion processes. The presence of fucose can influence the oligosaccharide's biological activity and its ability to bind to specific receptors. Additionally, 3-Fucosyllactose has garnered interest in research for its potential health benefits, including anti-inflammatory and anti-viral properties. As a non-toxic and naturally occurring substance, it is considered safe for consumption and is being studied for its applications in functional foods and nutraceuticals.
Formula:C18H32O15
InChI:InChI=1S/C18H32O15/c1-5-9(24)11(26)13(28)17(30-5)32-15(6(22)2-19)16(7(23)3-20)33-18-14(29)12(27)10(25)8(4-21)31-18/h2,5-18,20-29H,3-4H2,1H3/t5-,6-,7+,8+,9+,10-,11+,12-,13-,14+,15+,16+,17-,18-/m0/s1
InChI key:InChIKey=OVYANALZSAYBOJ-XOGIJULASA-N
SMILES:[C@@H]([C@H](O[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O1)[C@H](C=O)O)(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O
Synonyms:- 3-Fucosyllactose
- 3-O-α-<span class="text-smallcaps">L</span>-Fucopyranosyllactose
- 3-O-α-<span class="text-smallcaps">L</span>-Fucosyllactose
- 41312-47-4
- 6-deoxy-α-L-galactopyranosyl-(1->3)-[β-D-galactopyranosyl-(1->4)]-D-glucopyranose
- <span class="text-smallcaps">D</smallcap>-Glucose, O-6-deoxy-α-<smallcap>L</smallcap>-galactopyranosyl-(1→3)-O-[β-<smallcap>D</span>-galactopyranosyl-(1→4)]-
- O-6-Deoxy-α-<span class="text-smallcaps">L</smallcap>-galactopyranosyl-(1→3)-O-[β-<smallcap>D</smallcap>-galactopyranosyl-(1→4)]-<smallcap>D</span>-glucose
- 3-O-α-L-Fucopyranosyllactose
- O-6-Deoxy-α-L-galactopyranosyl-(1→3)-O-[β-D-galactopyranosyl-(1→4)]-D-glucose
- D-Glucose, O-6-deoxy-α-L-galactopyranosyl-(1→3)-O-[β-D-galactopyranosyl-(1→4)]-
- 3-O-α-L-Fucosyllactose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(2R,3R,4R,5R)-2,5,6-Trihydroxy-4-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-3-(((2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)hexanal
CAS:(2R,3R,4R,5R)-2,5,6-Trihydroxy-4-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-3-(((2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)hexanalPurity:98%Molecular weight:488.44g/mol3-Fucosyl-D-lactose
CAS:Formula:C18H32O15Purity:≥ 95.0%Color and Shape:White powder or solidMolecular weight:488.443-Fucosyllactose
CAS:Controlled ProductFormula:C18H32O15Color and Shape:White To Off-WhiteMolecular weight:488.443-Fucosyllactose
CAS:<p>3-Fucosyllactose (3-FL) is a small and neutral human milk oligosaccharide (HMO) that is metabolized by bacteria in the large intestine. It's a trisaccharide composed of L-fucose, D-galactose and D-glucose and like many other HMOs it offers great interest for the studies of baby milk formula.</p>Formula:C18H32O15Purity:Min. 95%Color and Shape:White PowderMolecular weight:488.44 g/mol3-Fucosyllactose
CAS:<p>3-Fucosyllactose, a key fucosylated oligosaccharide in human milk, offers prebiotic and immune benefits.</p>Formula:C18H32O15Color and Shape:SolidMolecular weight:488.44









