CAS 41324-66-7: L-Proline phenylmethyl ester

Description:L-Proline phenylmethyl ester, with the CAS number 41324-66-7, is an organic compound derived from the amino acid proline. It is characterized by the presence of a proline backbone with a phenylmethyl (benzyl) ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water due to its hydrophobic phenyl group. L-Proline phenylmethyl ester is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and as a chiral building block in asymmetric synthesis. Its structure allows it to participate in various chemical reactions, including esterification and amidation. Additionally, the presence of the proline moiety can impart unique properties, such as the ability to form specific conformations that may be beneficial in biological contexts. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.

Formula:C₁₂H₁₅NO₂

InChI:InChI=1S/C12H15NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2/t11-/m0/s1

InChI key:InChIKey=VVCLBQFBKZQOAF-NSHDSACASA-N

SMILES:O=C(OCC=1C=CC=CC1)C2NCCC2

Synonyms:
(S)-Benzyl prolinate
L-Proline benzyl ester
L-Proline phenylmethyl ester
Benzyl (2S)-pyrrolidine-2-carboxylate
Benzyl (S)-pyrrolidine-2-carboxylate
Benzyl L-prolinate
Nsc 206250
Proline benzyl ester
L-Proline benzyl ester
L-Proline phenylmethyl ester
See more synonyms
Benzyl L-prolinate
L-Proline, phenylmethyl ester
Benzyl L-prolinate

There are currently no products for this CAS.