CAS 4133-34-0
:7-Methoxy-2-tetralone
Description:
7-Methoxy-2-tetralone, with the CAS number 4133-34-0, is an organic compound belonging to the class of tetralones, which are bicyclic compounds featuring a ketone functional group. This particular compound is characterized by the presence of a methoxy group (-OCH3) at the 7-position of the tetralone structure, which contributes to its chemical reactivity and potential applications. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the fused ring system. The compound may exhibit various functional properties, including potential use in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility can vary in different solvents, and it may participate in typical reactions associated with ketones, such as nucleophilic addition and oxidation. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3
InChI key:InChIKey=XEAPZXNZOJGVCZ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1)CCC(=O)C2
Synonyms:- 2(1H)-Naphthalenone, 3,4-dihydro-7-methoxy-
- 3,4-Dihydro-7-methoxy-2(1H)-naphthalenone
- 7-Methoxy-1,2,3,4-tetrahydronaphthalen-2-one
- 7-Methoxy-2-tetralinone
- 7-Methoxy-3,4-dihydro-1H-naphthalen-2-one
- 7-Methoxy-β-tetralone
- 7-Methoxyl-2-Tetralone
- 7-methoxy-3,4-dihydronaphthalen-2(1H)-one
- 7-Methoxy-2-tetralone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dihydro-7-Methoxy-2(1H)-Naphthalenone
CAS:Formula:C11H12O2Purity:97%Color and Shape:SolidMolecular weight:176.21183,4-Dihydro-7-methoxynaphthalen-2(1H)-one
CAS:3,4-Dihydro-7-methoxynaphthalen-2(1H)-onePurity:98%Color and Shape:Yellow LiquidMolecular weight:176.21g/mol7-Methoxy-2-tetralone
CAS:7-Methoxy-2-tetralone is an organic compound that is synthesised from the chlorination of phenol. It inhibits cancer cells by binding to their receptors and inhibiting the growth of new blood vessels, which are necessary for tumour growth. 7-Methoxy-2-tetralone also inhibits the synthesis of DNA, RNA, and protein in a cell-free system. It binds to chloride ions in solution and has a potent inhibitory activity against dehydrogenase and hydrochloric acid. 7-Methoxy-2-tetralone is used as a reagent for water treatment studies because it can be broken down to produce harmless products, such as chloride ion and cyanogen.
Formula:C11H12O2Purity:Min. 95%Molecular weight:176.21 g/mol7-Methoxy-2-tetralone
CAS:Formula:C11H12O2Purity:97%Color and Shape:Solid, ClearMolecular weight:176.215




