CAS 41330-49-8

3-chloro-2H-indazol-5-amine

Description:

3-Chloro-2H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 3-position and an amino group at the 5-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been studied for their anti-cancer and anti-inflammatory properties. The compound's CAS number, 41330-49-8, is a unique identifier that facilitates its identification in chemical databases and literature. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 3-chloro-2H-indazol-5-amine represents a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₆ClN₃

InChI: InChI=1/C7H6ClN3/c8-7-5-3-4(9)1-2-6(5)10-11-7/h1-3H,9H2,(H,10,11)

SMILES: c1cc2c(cc1N)c(Cl)n[nH]2

Synonyms:

• 1H-indazol-5-amine, 3-chloro-
• 3-chloro-1H-indazol-5-amine

3-Chloro-1H-indazol-5-amine

CAS: 41330-49-8

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA00BY04

3-Chloro-1H-indazol-5-amine

CAS: 41330-49-8

3-Chloro-1H-indazol-5-amine

Purity: 95%

Molecular weight: 167.60g/mol

Ref: 54-OR111527

3-CHLORO-1H-INDAZOL-5-AMINE

CAS: 41330-49-8

Purity: 97%

Molecular weight: 167.6000061

Ref: 10-F800294

3-Chloro-1H-indazol-5-amine

CAS: 41330-49-8

Formula: C₇H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.6

Ref: 10-F223420