CAS 41332-59-6
:2,4-Dichloro-5-sulfobenzoic acid
Description:
2,4-Dichloro-5-sulfobenzoic acid is an aromatic sulfonic acid characterized by the presence of two chlorine atoms and a sulfonic acid group attached to a benzoic acid structure. It typically appears as a white to off-white solid and is soluble in water, which is a common trait for sulfonic acids due to their polar sulfonate group. This compound is known for its applications in various fields, including as a reagent in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Its chemical structure contributes to its reactivity, particularly in electrophilic substitution reactions, where the electron-withdrawing chlorine and sulfonic acid groups influence the positions of further substitutions on the aromatic ring. Additionally, 2,4-Dichloro-5-sulfobenzoic acid may exhibit biological activity, making it of interest in environmental and toxicological studies. Proper handling and safety measures are essential due to its potential hazards, including skin and eye irritation.
Formula:C7H4Cl2O5S
InChI:InChI=1S/C7H4Cl2O5S/c8-4-2-5(9)6(15(12,13)14)1-3(4)7(10)11/h1-2H,(H,10,11)(H,12,13,14)
InChI key:InChIKey=ZNAQCEMTUXNPPR-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(C(O)=O)=C(Cl)C=C1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
