CAS 41339-17-7
:3-Amino-5-nitroindazole
Description:
3-Amino-5-nitroindazole is an organic compound characterized by its indazole structure, which features a five-membered ring containing two nitrogen atoms. This compound is notable for the presence of an amino group (-NH2) and a nitro group (-NO2) at the 3 and 5 positions of the indazole ring, respectively. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the nitro group can undergo reduction reactions, making the compound versatile in synthetic chemistry. 3-Amino-5-nitroindazole is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many nitro-containing compounds, it may exhibit specific biological activities, warranting further investigation for potential therapeutic uses. Safety precautions should be taken when handling this compound due to the presence of the nitro group, which can pose health risks.
Formula:C7H6N4O2
InChI:InChI=1/C7H6N4O2/c8-7-5-3-4(11(12)13)1-2-6(5)9-10-7/h1-3H,(H3,8,9,10)
SMILES:c1cc2c(cc1N(=O)=O)c(=N)[nH][nH]2
Synonyms:- 5-Nitro-1H-indazol-3-amine
- 3-Amino-5-nitro-1H-indazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Nitro-1H-indazol-3-amine
CAS:Formula:C7H6N4O2Purity:98%Color and Shape:SolidMolecular weight:178.14813-Amino-5-nitro-1H-indazole
CAS:3-Amino-5-nitro-1H-indazolePurity:95%Color and Shape:SolidMolecular weight:178.15g/mol3-Amino-5-nitroindazole
CAS:3-Amino-5-nitroindazole is an anticancer drug that inhibits the growth of cancer cells. It has been shown to inhibit the growth of cancer cells by blocking the synthesis and repair of DNA, leading to cell death. 3-Amino-5-nitroindazole also blocks the production of new proteins, which are needed for cell division. This drug also acts on pathways that are important for tumor development and progression, such as signaling pathways and transcription factors. This compound has been shown to be selective against human squamous cell carcinoma cells and has been studied in combination with other anticancer drugs in clinical trials.
Formula:C7H6N4O2Purity:Min. 95%Color and Shape:SolidMolecular weight:178.15 g/mol5-Nitro-1H-indazol-3-amine
CAS:Formula:C7H6N4O2Purity:98%Color and Shape:Orange powderMolecular weight:178.151



