CAS 4134-97-8

(5R)-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-one

Description:

(5R)-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-one, with CAS number 4134-97-8, is a chemical compound characterized by its tetrahydropyran structure, which includes multiple hydroxyl (-OH) groups that contribute to its solubility in water and its potential reactivity. This compound features a chiral center at the 5-position, indicating that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. The presence of hydroxymethyl and dihydroxy groups suggests that it may participate in hydrogen bonding, enhancing its interactions with other molecules. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in drug development and as a building block for more complex molecules. Its stability, reactivity, and solubility characteristics make it a valuable compound for research and industrial applications. However, specific properties such as melting point, boiling point, and spectral data would require further investigation or reference to specialized databases for detailed information.

Formula: C₆H₁₀O₅

InChI: InChI=1/C6H10O5/c7-2-5-3(8)1-4(9)6(10)11-5/h3,5-8,10H,1-2H2/t3-,5?,6?/m1/s1

SMILES: C1[C@H](C(CO)OC(C1=O)O)O

3-Deoxy-D-galactosone

CAS: 4134-97-8

3-Deoxy-D-galactosone

Color and Shape: Solid

Molecular weight: 162.14g/mol

Ref: 54-BICL2197

3-Deoxy-galactosone

CAS: 4134-97-8

Formula: C₆H₁₀O₅

Color and Shape: Pale yellow to yellow solid

Molecular weight: 162.14

Ref: 7W-GC2330

3-Deoxygalactosone

CAS: 4134-97-8

Formula: C₆H₁₀O₅

Molecular weight: 162.14

Ref: 4Z-G-163002

3-Deoxygalactosone (>90%)

Controlled Product

CAS: 4134-97-8

Stability Hygroscopic
Applications It has carcinostatic activity.
References Reynolds, T.M., et al.: Advan. Food. Res., 14, 167 (1965), Szent-Gyorgyi, L.G., et al.: Science, 155, 539 (1967),

Formula: C₆H₁₀O₅

Purity: >90%

Color and Shape: Neat

Molecular weight: 162.14

Ref: TR-D237100

3-Deoxygalactosone

CAS: 4134-97-8

3-Deoxygalactosone is a reactive compound that is formed by the reaction of glyoxal and galactose. The glyoxal molecule reacts with the hydroxyl group on the galactose to form a new aldehyde, which can then react with another molecule of glyoxal or galactose to form 3-deoxygalactosone. 3-Deoxygalactosone has been shown to have health effects in clinical studies. It also has been shown to decrease the dry weight of rats fed a high-fat diet. This compound also is an intermediate in the formation of 5-hydroxymethylfurfural, which is produced during the Maillard reaction between sugars and amino acids. 3-Deoxygalactosone binds to proteins, forming hydrogen bonds with amino acid side chains and affecting their biological function.

Formula: C₆H₁₀O₅

Purity: 90%

Color and Shape: Yellow Powder

Molecular weight: 162.14 g/mol

Ref: 3D-MD09539

3-Deoxy-galactosone

CAS: 4134-97-8

3-Deoxy-galactosone, a 1,2-dicarbonyl compound, originates from the degradation of galactose. It forms in food during Maillard and caramelization reactions.

Formula: C₆H₁₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.141

Ref: TM-T19116