CymitQuimica logo

CAS 41340-39-0

:

N,N-Diethyl-4-[2-(2-oxo-3-tetradecyl-1-imidazolidinyl)ethyl]-1-piperazinecarboxamide

Description:
N,N-Diethyl-4-[2-(2-oxo-3-tetradecyl-1-imidazolidinyl)ethyl]-1-piperazinecarboxamide, with CAS number 41340-39-0, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring, an imidazolidine moiety, and a long aliphatic chain. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for compounds with long hydrophobic alkyl chains. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent or a surfactant, due to the presence of functional groups that can interact with biological systems. The diethyl substitution on the piperazine ring may enhance its lipophilicity, influencing its pharmacokinetic properties. Additionally, the imidazolidine component may contribute to its reactivity and potential interactions with various biological targets. Overall, this compound's unique structural features position it as a candidate for further research in medicinal chemistry and related fields.
Formula:C28H55N5O2
InChI:InChI=1S/C28H55N5O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-31-25-26-33(28(31)35)24-21-29-19-22-32(23-20-29)27(34)30(5-2)6-3/h4-26H2,1-3H3
InChI key:InChIKey=OQXWEZVLEIJVSI-UHFFFAOYSA-N
SMILES:C(CN1CCN(C(N(CC)CC)=O)CC1)N2C(=O)N(CCCCCCCCCCCCCC)CC2
Synonyms:
  • 1-Piperazinecarboxamide, N,N-diethyl-4-[2-(2-oxo-3-tetradecyl-1-imidazolidinyl)ethyl]-
  • Impacarzine
  • N,N-Diethyl-4-[2-(2-oxo-3-tetradecyl-1-imidazolidinyl)ethyl]-1-piperazinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.