CAS 41345-70-4
:3-(acetylsulfanyl)propanoic acid
Description:
3-(Acetylsulfanyl)propanoic acid, identified by its CAS number 41345-70-4, is an organic compound characterized by the presence of a propanoic acid backbone with an acetylsulfanyl group attached to the third carbon. This compound features a carboxylic acid functional group, which imparts acidic properties, and a thioether functional group due to the acetylsulfanyl moiety. The presence of sulfur in the structure can influence its reactivity and solubility, often making it more polar compared to similar compounds without sulfur. The acetyl group contributes to the compound's overall stability and can affect its interaction with biological systems, potentially making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and esterifications. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-(acetylsulfanyl)propanoic acid represents a unique compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C5H8O3S
InChI:InChI=1/C5H8O3S/c1-4(6)9-3-2-5(7)8/h2-3H2,1H3,(H,7,8)
SMILES:CC(=O)SCCC(=O)O
Synonyms:- Propanoic Acid, 3-(Acetylthio)-
- 3-(Acetylsulfanyl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Acetylthio)propionic Acid
CAS:Formula:C5H8O3SPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:148.183-(Acetylthio)propionic acid
CAS:Formula:C5H8O3SPurity:95%Color and Shape:SolidMolecular weight:148.18023-(Acetylthio)propionic Acid
CAS:Controlled ProductApplications A useful synthetic intermediate.
References Li, A., et al.: J. Med. Chem., 42, 706 (1999), Low, E., et al.: Bioorg. Med. Chem. Lett., 19, 196 (2009),Formula:C5H8O3SColor and Shape:NeatMolecular weight:148.18




