CAS 41349-15-9
:platinum(2+) azanide - ethanedioic acid (1:2:1)
Description:
Platinum(2+) azanide - ethanedioic acid (1:2:1), with the CAS number 41349-15-9, is a coordination compound featuring platinum in a +2 oxidation state coordinated with azanide (an amide-like ligand) and ethanedioic acid (also known as oxalic acid). This compound typically exhibits characteristics associated with platinum complexes, such as potential catalytic activity and unique electronic properties due to the presence of the platinum metal center. The azanide ligand contributes to the overall stability and solubility of the complex, while the ethanedioic acid provides additional coordination sites and can influence the compound's reactivity and interaction with other molecules. The stoichiometry of 1:2:1 indicates a specific ratio of platinum to the ligands, which can affect the geometry and electronic structure of the complex. Such compounds are of interest in various fields, including catalysis, materials science, and medicinal chemistry, due to their potential applications in drug development and as catalysts in chemical reactions.
Formula:C2H6N2O4Pt
InChI:InChI=1/C2H2O4.2H2N.Pt/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);2*1H2;/q;2*-1;+2
InChI key:InChIKey=PMYNWPKKFGOGDB-UHFFFAOYSA-L
SMILES:[NH3][Pt+2]1([NH3])[O-]C(=O)C(=O)[O-]1
Synonyms:- (SP-4-2)-Diammine[ethanedioato(2-)-κO1,κO2]platinum
- Diammineplatinum(II) oxalate
- Platinum, diammine[ethanedioato(2-)-O,O′]-, (SP-4-2)-
- cis-Oxalodiammine platinum (II)
- Platinum, diammine[ethanedioato(2-)-κO1,κO2]-, (SP-4-2)-
- Nedaplatin Impurity 1 (cis-Diamminooxalatoplatinum)
- cis-Diamminooxalatoplatinum
- Nedaplatin Impurity 1
- Platinum (II), diammineoxalato-, cis-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
