CAS 4135-11-9
:(6R)-N-[(2S)-4-amino-1-{[(2S,3R)-1-{[(2S)-4-amino-1-oxo-1-{[(3S,6R,9S,12S,15S,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl]amino}butan-2-y
Description:
The chemical substance with the name provided is a complex peptide derivative, characterized by its intricate structure that includes multiple amino acid residues and a cyclic framework. It features a heptaazacyclotricosane core, which is a cyclic compound containing nitrogen atoms in its ring structure, contributing to its potential biological activity. The presence of multiple amino groups suggests that it may exhibit strong interactions with biological targets, such as enzymes or receptors. Additionally, the compound's structure includes various functional groups, such as amines and carbonyls, which can influence its solubility, stability, and reactivity. The stereochemistry indicated by the (R) and (S) designations suggests that the molecule has specific spatial arrangements that are crucial for its biological function. Overall, this substance is likely to be of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications, although its complexity may also pose challenges in synthesis and characterization.
Formula:C56H98N16O13
InChI:InChI=1/C56H98N16O13/c1-7-32(4)13-11-12-16-44(75)63-36(17-23-57)51(80)72-46(34(6)74)56(85)68-39(20-26-60)48(77)67-41-22-28-62-55(84)45(33(5)73)71-52(81)40(21-27-61)65-47(76)37(18-24-58)66-53(82)42(29-31(2)3)69-54(83)43(30-35-14-9-8-10-15-35)70-49(78)38(19-25-59)64-50(41)79/h8-10,14-15,31-34,36-43,45-46,73-74H,7,11-13,16-30,57-61H2,1-6H3,(H,62,84)(H,63,75)(H,64,79)(H,65,76)(H,66,82)(H,67,77)(H,68,85)(H,69,83)(H,70,78)(H,71,81)(H,72,80)/t32-,33-,34-,36+,37+,38+,39+,40-,41+,42+,43+,45+,46+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Polymyxin B1 Pentatrifluoroacetate
CAS:Formula:C56H98N16O13·5C2HF3O2Color and Shape:White To Off-White SolidMolecular weight:1203.50 5*114.02Polymyxin B1
CAS:Polymyxin B1: potent lipopeptide against multidrug-resistant Gram-negative bacteria; from Bacillus polymyxa.Formula:C56H98N16O13Purity:98%Color and Shape:SolidMolecular weight:1203.48Polymyxin B1-d3
CAS:Polymyxin B1-d3 is a polymyxin antibiotic that is effective against gram-negative bacteria. It binds to the cell membrane and causes it to leak, leading to cell lysis. Polymyxin B1-d3 has been shown to be effective against antibiotic-resistant strains of bacteria, such as Enterobacteriaceae, Pseudomonas aeruginosa, and Acinetobacter baumannii. The phase transition temperature for this substance is about 30 degrees Celsius, so it should not be used in patients with fever or hyperthermia. Polymyxin also has a systolic pressure lowering effect, which may be due to its ability to inhibit the synthesis of cyclic peptides.
Formula:C56H98N16O13Purity:Min. 95%Molecular weight:1,203.5 g/mol



