CAS 413589-35-2

chloro(2-chloro-6-fluorobenzyl)magnesium

Description:

Chloro(2-chloro-6-fluorobenzyl)magnesium is an organomagnesium compound, commonly classified as a Grignard reagent. It features a magnesium atom bonded to a chloro-substituted benzyl group, specifically 2-chloro-6-fluorobenzyl. This compound is typically characterized by its reactivity, particularly with electrophiles, due to the presence of the magnesium-carbon bond, which is highly nucleophilic. The presence of chlorine and fluorine substituents on the aromatic ring can influence its reactivity and stability, potentially enhancing its electrophilic character. Grignard reagents like this one are generally sensitive to moisture and air, requiring an anhydrous environment for storage and handling. They are widely used in organic synthesis for the formation of carbon-carbon bonds, allowing for the construction of complex molecules. Additionally, the specific substituents in chloro(2-chloro-6-fluorobenzyl)magnesium may impart unique properties, such as altered solubility and reactivity profiles compared to other Grignard reagents.

Formula: C₇H₅Cl₂FMg

InChI: InChI=1/C7H5ClF.ClH.Mg/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl2FMg/c8-6-2-1-3-7(10)5(6)4-11-9/h1-3H,4H2

SMILES: C=C1C(C=CC=C1F)Cl.Cl.[Mg]

2-Chloro-6-fluorobenzylmagnesium chloride

CAS: 413589-35-2

2-Chloro-6-fluorobenzylmagnesium chloride

Purity: ≥95%

Molecular weight: 203.32g/mol

Ref: 54-PC7246