CAS 41359-15-3
:5-(hydroxymethyl)-3-{[(5-nitrofuran-2-yl)methylidene]amino}-1,3-oxazolidin-2-one
Description:
5-(Hydroxymethyl)-3-{[(5-nitrofuran-2-yl)methylidene]amino}-1,3-oxazolidin-2-one is a chemical compound characterized by its oxazolidinone core, which is a five-membered heterocyclic ring containing both nitrogen and oxygen. This compound features a hydroxymethyl group, which contributes to its potential reactivity and solubility in polar solvents. The presence of a nitrofuran moiety indicates that it may exhibit biological activity, as nitrofuran derivatives are often associated with antimicrobial properties. The methylidene linkage suggests that it may participate in various chemical reactions, including condensation and nucleophilic attacks. The overall structure implies that this compound could be of interest in medicinal chemistry, particularly in the development of new pharmaceuticals. Its CAS number, 41359-15-3, allows for easy identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. As with many compounds containing functional groups like nitro and hydroxymethyl, it may also exhibit specific reactivity patterns and stability considerations under various conditions.
Formula:C9H9N3O6
InChI:InChI=1/C9H9N3O6/c13-5-7-4-11(9(14)18-7)10-3-6-1-2-8(17-6)12(15)16/h1-3,7,13H,4-5H2
Synonyms:- 5-(hydroxymethyl)-3-[(5-nitro-2-furyl)methylideneamino]oxazolidin-2-one
- Nifuratel-005
- 2-Oxazolidinone, 5-(hydroxymethyl)-3-[[(5-nitro-2-furanyl)methylene]amino]-
- 5-(hydroxymethyl)-3-(((5-nitrofuran-2-yl)methylene)amino)oxazolidin-2-one
- Nifuratel Impurity 6
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

