CAS 4136-97-4: Methyl 4-amino-2-hydroxybenzoate
Description:Methyl 4-amino-2-hydroxybenzoate, also known as methyl paraben, is an organic compound that belongs to the class of parabens, which are widely used as preservatives in cosmetics, pharmaceuticals, and food products. It is characterized by its aromatic structure, featuring a para-amino group and a hydroxyl group on a benzoate ring, along with a methyl ester functional group. This compound is typically a white crystalline solid with a slight solubility in water, but it is more soluble in organic solvents such as ethanol and acetone. Methyl 4-amino-2-hydroxybenzoate exhibits antimicrobial properties, making it effective in preventing the growth of bacteria and fungi, which is crucial for extending the shelf life of products. Additionally, it has a relatively low toxicity profile, contributing to its widespread use. However, concerns regarding potential endocrine-disrupting effects have led to ongoing research and regulatory scrutiny regarding its safety in consumer products. Overall, its chemical stability and preservative qualities make it a valuable compound in various industries.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,9H2,1H3
InChI key:InChIKey=QQOXBFUTRLDXDP-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=C(N)C=C1O
- Synonyms:
- 2-Hydroxy-4-aminobenzoic acid methyl ester
- 3-Hydroxy-4-methoxycarbonylaniline
- 4-Amino-2-hydroxybenzoic acid methyl ester
- 4-Aminosalicylic acid methyl ester
- Benzoic acid, 4-amino-2-hydroxy-, methyl ester
- Methyl 2-hydroxy-4-aminobenzoate
- Methyl 4-Amino-2-Hydroxybenzoate
- Methyl 4-aminosalicylate
- NSC 30263
- NSC 48927
- See more synonyms
- Salicylic acid, 4-amino-, methyl ester
- Salicylic acid, amino-, methyl ester
- p-Aminosalicylic acid methyl ester
- Methyl p-aminosalicylate
