CAS 413606-16-3

Formula: C17H12BrN3O4S

InChI: InChI=1S/C17H12BrN3O4S/c18-14-6-7-15(13-4-2-1-3-12(13)14)25-10-16(22)20-19-9-11-5-8-17(26-11)21(23)24/h1-9H,10H2,(H,20,22)/b19-9+

InChI key: WINFLSGAKLBJTB-DJKKODMXSA-N

SMILES: C1=CC=C2C(=C1)C(=CC=C2Br)OCC(=O)N/N=C/C3=CC=C(S3)[N+](=O)[O-]

2-((4-Bromonaphthalen-1-yl)oxy)-N'-((5-nitrothiophen-2-yl)methylene)acetohydrazide

CAS: 413606-16-3

Formula: C₁₇H₁₂BrN₃O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 434.2639

Ref: IN-DA01XBXW

MitoBloCK-11 (MB-11)

CAS: 413606-16-3

MitoBloCK-11 (MB-11)

Formula: C₁₇H₁₂BrN₃O₄S

Purity: ≥98%

Molecular weight: 434.26

Ref: 54-BUP07132

MitoBloCK-11 (MB-11)

CAS: 413606-16-3

MB-11 inhibits mitochondrial protein import, targets Seo1, affects growth in uracil-free media, and disrupts zebrafish development.

Formula: C₁₇H₁₂BrN₃O₄S

Purity: 98.03%

Color and Shape: Solid

Molecular weight: 434.26

Ref: TM-T8782

Mitoblock-11

CAS: 413606-16-3

Mitoblock-11 is an analog of a natural compound found in Chinese medicinal herbs that has been shown to have potent anticancer activity. It is a kinase inhibitor that targets proteins involved in cell growth and survival, leading to apoptosis (programmed cell death) of cancer cells. Mitoblock-11 has been shown to be effective against various human tumor cell lines, inhibiting their growth and inducing apoptosis. This compound is excreted in urine and can be used as a biomarker for its pharmacokinetic properties. Its unique mechanism of action makes it a promising candidate for the development of new cancer therapies.

Formula: C₁₇H₁₂BrN₃O₄S

Purity: Min. 95%

Molecular weight: 434.3 g/mol

Ref: 3D-NRA60616