CAS 41365-75-7
:1-Amino-3,3-diethoxypropane
Description:
1-Amino-3,3-diethoxypropane, with the CAS number 41365-75-7, is an organic compound characterized by the presence of an amino group and two ethoxy groups attached to a propane backbone. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents due to its ether functionalities. The amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Its structure suggests potential applications in organic synthesis, particularly as a building block for more complex molecules or as a reagent in the preparation of amines and other derivatives. Additionally, the presence of ethoxy groups can enhance its reactivity and solubility in different environments. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, 1-amino-3,3-diethoxypropane is a versatile compound with potential utility in both academic and industrial chemistry settings.
Formula:C7H18NO2
InChI:InChI=1/C7H17NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-6,8H2,1-2H3/p+1
Synonyms:- 1-Propanamine, 3,3-Diethoxy-
- 3,3-Diethoxypropylamine
- Propionaldehyde, 3-amino-, diethyl acetal
- 3,3-Diethoxypropan-1-Amine
- 3,3-Diethoxypropan-1-Aminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,3-Diethoxypropan-1-amine
CAS:Formula:C7H17NO2Purity:95%Color and Shape:LiquidMolecular weight:147.2154Ref: 54-OR73421
1mlTo inquire5gTo inquire5mlTo inquire10gTo inquire25gTo inquire25mlTo inquire100gTo inquire100mlTo inquire500mlTo inquire3,3-Diethoxypropan-1-amine
CAS:Formula:C7H17NO2Purity:95%Color and Shape:LiquidMolecular weight:147.2183,3-Diethoxypropan-1-amine
CAS:3,3-Diethoxypropan-1-amine is a synthetic drug that reversibly inhibits the growth of bacteria. It has been shown to be effective against methicillin resistant strains of Staphylococcus aureus and Clostridium perfringens, with no detectable activity against acid-fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex. 3,3-Diethoxypropan-1-amine is a heterobifunctional compound that binds to epidermal growth factor with high affinity. 3,3-Diethoxypropan-1-amine can also bind to collagen and liposomal formulations, which may be useful for the treatment of wounds. This drug has been shown to inhibit δ opioid receptors in mice and rats, which is thought to contribute to its analgesic effects.Formula:C7H17NO2Purity:Min. 95%Molecular weight:147.22 g/mol



