
CAS 41385-14-2
:L-Glutamic acid, 5-methyl ester, polymer with L-leucine
Description:
L-Glutamic acid, 5-methyl ester, polymer with L-leucine, identified by CAS number 41385-14-2, is a synthetic polymer that combines the amino acids L-glutamic acid and L-leucine. This compound exhibits characteristics typical of polypeptides, including biocompatibility and potential biodegradability, making it suitable for various applications in biomedicine and materials science. The presence of L-glutamic acid contributes to its hydrophilicity, while L-leucine enhances its hydrophobic properties, allowing for unique interactions in biological systems. The polymer's structure may influence its solubility, thermal stability, and mechanical properties, which are critical for applications such as drug delivery systems, tissue engineering, and as additives in food and cosmetics. Additionally, the polymer's amino acid composition can affect its biological activity, potentially influencing cell signaling and metabolic processes. Overall, this compound represents a versatile material with promising applications in various fields, particularly where biocompatibility and functional properties are essential.
Formula:(C6H13NO2·C6H11NO4)x
InChI:InChI=1S/C6H11NO4.C6H13NO2/c1-11-5(8)3-2-4(7)6(9)10;1-4(2)3-5(7)6(8)9/h4H,2-3,7H2,1H3,(H,9,10);4-5H,3,7H2,1-2H3,(H,8,9)/t4-;5-/m00/s1
InChI key:InChIKey=ACYNOJOVIUFXEQ-KDDYFZQKSA-N
SMILES:C(CC(OC)=O)[C@@H](C(O)=O)N.[C@H](CC(C)C)(C(O)=O)N
Synonyms:- L-Leucine, polymer with 5-methyl hydrogen L-glutamate
- L-Leucine-γ-methyl L-glutamate copolymer
- L-Leucine-γ-methyl L-glutamate polymer
- L-Glutamic acid, 5-methyl ester, polymer with L-leucine
- γ-Methyl-L-glutamate-L-leucine copolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Leuciglumer
CAS:Leuciglumer is a bioactive chemical.
Formula:C12H24N2O6Color and Shape:SolidMolecular weight:292.33
