CymitQuimica logo

CAS 41401-36-9

:

4-(4-Iodophenyl)-3-thiosemicarbazide

Description:
4-(4-Iodophenyl)-3-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which features a sulfur atom bonded to a carbonyl carbon. This compound contains an iodine atom attached to a phenyl ring, contributing to its unique properties. It typically appears as a solid and may exhibit a range of colors depending on its purity and crystalline form. The presence of the iodine substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. Thiosemicarbazides are known for their potential as antimicrobial, antiviral, and anticancer agents, and this specific compound may exhibit similar biological activities. Its solubility can vary in different solvents, and it may participate in various chemical reactions, including condensation and substitution reactions. Safety data should be consulted, as compounds containing iodine and sulfur can pose health risks if not handled properly. Overall, 4-(4-Iodophenyl)-3-thiosemicarbazide represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C7H8IN3S
InChI:InChI=1/C7H8IN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12)
SMILES:c1cc(ccc1I)NC(=NN)S
Synonyms:
  • N-(4-iodophenyl)hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.