CAS 41408-19-9
:2-methyl-2-(4-methylpent-3-en-1-yl)-7-propyl-2H-chromen-5-ol
Description:
2-Methyl-2-(4-methylpent-3-en-1-yl)-7-propyl-2H-chromen-5-ol, with the CAS number 41408-19-9, is a chemical compound belonging to the class of flavonoids, specifically a type of chromenol. This compound features a chromen-5-ol backbone, which is characterized by a fused benzopyran structure. The presence of multiple substituents, including a methyl group and a propyl chain, contributes to its structural complexity and potential biological activity. The 4-methylpent-3-en-1-yl group introduces an alkene functionality, which may enhance its reactivity and influence its interactions in biological systems. Generally, flavonoids are known for their antioxidant properties, and this compound may exhibit similar characteristics, potentially contributing to various health benefits. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties, biological activities, and potential applications in fields such as pharmacology and food science.
Formula:C19H26O2
InChI:InChI=1/C19H26O2/c1-5-7-15-12-17(20)16-9-11-19(4,21-18(16)13-15)10-6-8-14(2)3/h8-9,11-13,20H,5-7,10H2,1-4H3
SMILES:CCCc1cc(c2C=CC(C)(CCC=C(C)C)Oc2c1)O
Synonyms:- 2H-1-Benzopyran-5-ol, 2-methyl-2-(4-methyl-3-pentenyl)-7-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Cannabichromevarin
CAS:<p>Cannabichromevarin is a cannabinoid that can be found in Cannabis sativa.</p>Formula:C19H26O2Color and Shape:SolidMolecular weight:286.41Cannabichromevarin (CBCV) 1000 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C19H26O2Color and Shape:Single SolutionMolecular weight:286.41Cannabichromevarin (CBCV) 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C19H26O2Color and Shape:Single SolutionMolecular weight:286.41(±)-Cannabichromevarin (CBCV)
CAS:Controlled ProductFormula:C19H26O2Color and Shape:NeatMolecular weight:286.41

