CymitQuimica logo

CAS 4141-19-9

:

cis-1,3-O-benzylideneglycerol

Description:
Cis-1,3-O-benzylideneglycerol is an organic compound characterized by its unique structure, which includes a glycerol backbone with benzylidene groups at the 1 and 3 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in organic synthesis and as a building block in the development of various chemical compounds. The presence of the benzylidene groups contributes to its reactivity, allowing for further functionalization in chemical reactions. Additionally, cis-1,3-O-benzylideneglycerol may exhibit interesting physical properties such as solubility in organic solvents and moderate stability under standard conditions. Its specific interactions and reactivity can be influenced by the stereochemistry of the molecule, which is crucial for its behavior in chemical processes. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-,10+
InChI key:BWKDAAFSXYPQOS-UHFFFAOYSA-N
SMILES:C1C(COC(O1)C2=CC=CC=C2)O
Synonyms:
  • Cis-2-Phenyl-1,3-Dioxan-5-Ol
Found 6 products.