CAS 41420-90-0

2-(4-bromophenyl)-1,3,4-oxadiazole

Description:

2-(4-Bromophenyl)-1,3,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring structure. The compound features a bromophenyl substituent at the 2-position of the oxadiazole, contributing to its unique chemical properties. It typically exhibits moderate to high stability under standard conditions and may display notable solubility in organic solvents. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, compounds of this class often exhibit interesting biological activities, including antimicrobial and anticancer properties. The molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Overall, 2-(4-bromophenyl)-1,3,4-oxadiazole is a versatile compound with applications in research and industry, particularly in the fields of organic synthesis and drug discovery.

Formula: C₈H₅BrN₂O

InChI: InChI=1/C8H5BrN2O/c9-7-3-1-6(2-4-7)8-11-10-5-12-8/h1-5H

SMILES: c1cc(ccc1c1nnco1)Br

Synonyms:

• 1,3,4-Oxadiazole, 2-(4-Bromophenyl)-

2-(4-Bromophenyl)-1,3,4-oxadiazole

CAS: 41420-90-0

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA00721O

2-(4-Bromophenyl)-1,3,4-oxadiazole

CAS: 41420-90-0

2-(4-Bromophenyl)-1,3,4-oxadiazole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 225.04g/mol

Ref: 54-OR110417

2-(4-Bromophenyl)-1,3,4-oxadiazole

CAS: 41420-90-0

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.045

Ref: 10-F235178

2-(4-Bromophenyl)-1,3,4-oxadiazole

CAS: 41420-90-0

The present invention relates to a method of fabricating an electrochemical device. The method comprises providing a substrate, depositing on the substrate a polymer matrix comprising poly(ethylene oxide) and 2-(4-bromophenyl)-1,3,4-oxadiazole monomers, and thermally treating the deposited polymer matrix. The device can be used in voltammetry techniques and has optical properties that are marginally affected by the presence of the 2-(4-bromophenyl)-1,3,4-oxadiazole monomers.

Formula: C₈H₅BrN₂O

Purity: Min. 95%

Molecular weight: 225.04 g/mol

Ref: 3D-RBA42090