CAS 41424-36-6
:1,3,5-tribromo-2-methoxy-4-methylbenzene
Description:
1,3,5-Tribromo-2-methoxy-4-methylbenzene, with the CAS number 41424-36-6, is an organic compound belonging to the class of brominated aromatic compounds. It features a benzene ring substituted with three bromine atoms at the 1, 3, and 5 positions, a methoxy group (-OCH3) at the 2 position, and a methyl group (-CH3) at the 4 position. This compound is characterized by its high degree of bromination, which typically enhances its reactivity and potential applications in various chemical processes, including synthesis and material science. The presence of the methoxy and methyl groups contributes to its overall hydrophobicity and influences its solubility in organic solvents. Additionally, the bromine substituents can impart significant biological activity, making it of interest in studies related to environmental chemistry and toxicology. The compound's structure suggests potential uses in pharmaceuticals, agrochemicals, or as a flame retardant, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C8H7Br3O
InChI:InChI=1/C8H7Br3O/c1-4-5(9)3-6(10)8(12-2)7(4)11/h3H,1-2H3
SMILES:Cc1c(cc(c(c1Br)OC)Br)Br
Synonyms:- Benzene, 1,3,5-Tribromo-2-Methoxy-4-Methyl-
- Methyl 2,4,6-tribromo-3-methylphenyl ether
- 1,3,5-TRIBROMO-2-METHOXY-4-METHYLBENZENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3,5-Tribromo-2-methoxy-4-methylbenzene
CAS:Formula:C8H7Br3OColor and Shape:SolidMolecular weight:358.85261,3,5-Tribromo-2-methoxy-4-methylbenzene
CAS:1,3,5-Tribromo-2-methoxy-4-methylbenzene
Molecular weight:358.85g/mol

