CymitQuimica logo

CAS 4144-55-2

:

4-Oxododecanoic acid

Description:
4-Oxododecanoic acid, also known as 4-oxotridecanoic acid, is a fatty acid characterized by a long hydrocarbon chain with a ketone functional group at the fourth carbon position from the carboxylic acid end. Its molecular structure consists of a 12-carbon backbone, making it a medium-chain fatty acid. The presence of the ketone group introduces unique reactivity and properties compared to typical saturated fatty acids. This compound is typically a white to pale yellow solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 4-Oxododecanoic acid can be involved in various chemical reactions, including esterification and oxidation, and may serve as an intermediate in the synthesis of other organic compounds. Its applications can extend to the fields of biochemistry, materials science, and potentially in the development of surfactants or emulsifiers. As with many fatty acids, it may exhibit biological activity, although specific biological properties would require further investigation.
Formula:C12H22O3
InChI:InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-11(13)9-10-12(14)15/h2-10H2,1H3,(H,14,15)
InChI key:InChIKey=HJMCWLADNPBBMN-UHFFFAOYSA-N
SMILES:C(C(CCC(O)=O)=O)CCCCCCC
Synonyms:
  • 4-Oxododecanoic acid
  • 4-Oxolauric acid
  • Dodecanoic acid, 4-oxo-
Found 2 products.